Você está na página 1de 14

2012

QUESTO ITEM
1

ANA ELIS

HUDSON CARMINATI

Nathlia Martins

V = VM.ln(5)

V = VM.ln(5)

Potencia = 478,9 kW

W' = 478,95 kW

Ts = 130 C; Ti = 120 C

Idem

meter = 275,7 kg/min

meter = 267,7 kg/min

5a
b

nA = 7,92.10^-5 kg/(s.m2)
x = 7,92.10^-5 mm/s

Idem
Idem

idem
idem

P = 25,64 atm

P = 51,25 atm

P=51,28 atm

Terica

8a
b

Terica
Vazo CO2 = 393,8 m3/h

V' = 393,6 m3/h


Ws= 14,29z2 - 447,94

idem

ANA ELIS
QUESTO

HUDSON CARMINATI

ITEM
1

xp = 0,568 yp = 0,909; xh = 0,432 yh =

Idem

Potencia = 14,8 kW

Q' = 53,1 MW

Falta

Ky = 2E-4 kmol/s.m | NA = 8E-6 kmol/s.m |

Tenso = 50N/m2; Velocidade = 2,5 m/s Idem

Falta

V = 9384 mL

V = 9,38 L

[N2] = 0,786 mol/L; [O2] = 0,596 mol/L;

[N2] = 0,988 mol/L; [O2] = 0,798 mol/L; [NO]

m = 455,45 g/h

m = 423,63 g/h

Caf = 1 mol/L

Idem

10

Terica

BRUNA
xp=0,23 yp=0,369; xh=0,33 yh=0,069
Obs: Tb encontrei resultado Ana Elis,
Q=1475W
Ky=4,35*10^-4kmol/(s*m^2) |
yai=0,0652; xai=0,00374
Idem
vt=0,54cm/s
V=9,38L
[N2]=0,978mol/L; [O2]=0,788mol/L;
m'=285,6g/h
Idem

2010
QUESTO ITEM
1

FELIPE DENARDIN
ANA ELIS
q = h(Tf Tar)
Tf = qL/h + Tar

q = h(Tf Tar)
Tf = qL/h + Tar

2a
b

VA = (VB2 + 2(PB = PA)/)1/2


Q = SA.SB.(2(PB-PA)/(SB2-SA2))1/2

VA = (VB2 + 2(PB = PA)/)1/2


Q = SA.SB.(2(PB-PA)/(SB2-SA2))1/2

3a
b

Fp = 135 mol/h
V = 3000 L e T = 20 h

Fp = 135 mol/h
V = 3000 L e T = 20 h

4a
b

t = V/qe = (D2(hf hi))/4qe


T = (Q.t/m.Cp) + Ti

t = V/qe = (D2(hf hi))/4qe


T = (Q.t/m.Cp) + Ti

m = 1547,1 kg
r = 82,9%

m=1531,81 kg
r=~84%

6a
b
c
d

xL = 0,214 (massica); L = 19,23 kg/s; F =


Q = 7066,1 kJ/s
Terica
m = 2,81 kg/s

F=~37,8 ks/s; L=~ 27,8 ks/s;


Q=7949,5 kj/s
?
m=3,57 kg/s

Terica

8a
b

xCH4 = 0,75; xO2 = 0,045; xC7H8 =


m = 1,66 kg CH4/kg gas

a
b

xCH4 = 0,75; xO2 = 0,045; xC7H8 =


m = 1,66 kg CH4/kg gas

HUDSON CARMINATI

Nathlia Martins

BRUNA

Idem
Idem

q/A=h*(Tf-Tar)
Tf=Tar+(q/(A^2*(hL-K)))

VA = (VB2 + 2(PB - PA)/)1/2


Idem

VA = (VB2 + 2(PB - PA)/)1/2


?? Gostaria da resoluo Q (compartilhem por

Idem
Idem

idem
idem

idem
Idem

t = (D2(hf hi))/4qe
Idem

t = (D2(hf hi))/4qe
Tf=Ti+((4Qt/D^2hfCp)-(Q*(hf-hi)/(qe*Cp*hf)))

m = 1,55 t
r = 0,83

m=1531,81 kg ?
r=83,75%

xL = 0,21 ; L = 20,84 kg/s ;


Q = 7329,8 kJ/s
m' = 3,40 kg/s

Idem
Idem

compartilhem as resolues por favor!

2009
QUEST ITEM
1a
b

ANA ELIS

FELIPE DENARDIN

90,9 kg/h
0,03 kg gua/ kg ar seco

91 kg/h
0,0282 kg agua/kg arseco

2a
b

H = 32 m; P = 16000 W
h34 = -5 m = -50 J/kg

H=32 m P=16000 W
h34=11,1 m = 111J/kg

3a
b

q" = 96154 W/m2


T1 = 238,46 C

Q/A=96150W/m
Ti=238,5C

4a
b

k = 0,15 min-1
q = 7,89 L/min

k=0,15/min
V=7,9L/min

NCO ~ 0; NO2 ~ 3,9 mols; NCO2 ~0,2

NCO ~ 0; NO2 ~ 3,9 mols; NCO2 ~0,2

6a
b

m = 500 kg
Terica

m=500kg/h
sim, diminui o consumo de carvo

7a
b

Terica
Terica

corroso galvnica, dilatao


ando de sacrifcio, corrente impressa

8a
b

Terica

HUDSON CARMINATI

Nathlia Martins

m' = 90,9 kg/h


U = 0,028 kg gua/ kg ar seco

90,91 kg/h
282 kggua/kgarseco

H = 32 m; P = 16000 W
h34 = -5 m = -50 J/kg

idem
h=37 m = 370J/kg

q" = 96154 W/m2


TS1 = 238,46 C
Idem
q = 7,89 L/min

idem
idem

Idem

idem

Idem

2008
QUEST ITEM
1a
b
c

ANA ELIS

FELIPE DENARDIN

Taxa de calor qr = 635400 kcal/h


Vazo vapor de gua Va = 1309,97 kg/h
Vazo da corrente Vn+1 = 1184,7 kg/h

Q=635400kcal/h
VA=1309,96/kg/h
Vn+1=1184,69kg/h

2a
b
c
d

W1 = -nRT1ln(P1/P2); Q1 = nRT1ln(P1/P2)
W2 = -nR(T2-T1); Q2 = Cpn(T2-T1)
T2 = 579,9K
P2 = e1,953

W1=Q1=119,6 kj
W2=-19,6 kj; Q2=133,6 kj
T2= 518 K
P2=P1e(1,798)

3a
b

*TABELA (linha 29)


Perda de carga P = 0,9784 m

Perda de carga P = 0,9788 m

Falta

Teorica

5a
b

Sim, pois mpy = 0,32 pol/ano


Terica

mpy=0,0222cm/ano (?)
-

6a
b
c

Anidrido actico
2 CH3COOH > CH3COOCOCH3 + H2O
Quantidade de cido necessria = 240g

Anidrido actico
2 CH3COOH > CH3COOCOCH3 + H2O
Quantidade de cido necessria = 240g

Falta

YAn+1 = 5,26E-2; YAa=5,26E-3


XAa=1,12E-3; m=1,9; A=2,468

8a
b

P, desprezando perdas = 6879,7 W


P, considerando perdas = 7085,3 W

a) Pot=6875 W
b) Pot=7080 W

*TABELA
1
2
3
4
5
6
7

Nre
CD
2.0455
1.2625
1.0645
0.8927
0.7509
0.6303
0.5295

Nre
14.171
22.021
25.793
26.885
31.961
38.077
45.328

2.04
1.26
1.06
0.89
0.75
0.63
0.53
CD
14.19
22.06
25.98
26.96
32
38.09
45.28
CDX/DP
1534
10700
17104
14513
7035
4488
6332
Soma=61706

HUDSON CARMINATI

DENIS

qr = 635400 kcal/h
Va = 1310 kg/h
Vn+1 = 1185 kg/h

qr = 635400 kcal/h
VA = 1310 kg/h
Vn+1 = 1186 kg/h

Idem Ana Elis


Idem Ana Elis
Idem Ana Elis
Idem Ana Elis

W1 = - Q1 = nRT1 ln (p2/p1)
W2 = 166,3 (T2 - 400) ; Q2 = 800 (T2 - 400)
T2 = 518 K
p2 = 3,35 bar

Soma CDX/DP = 61435,96


P = 97376 m

Arreguei

Idem
Idem
Idem
YAn+1 = 0,0526; YAa=0,0218
XAa=0; m=1,9; A=0,155
W'=6875 W
W'=7080,4 W

Anidrido actico
2 CH3COOH > CH3COOCOCH3 + H2O
Quantidade de cido necessria = 240g

BRUNA
Taxa de calor qr = 635400 kcal/h
Vazo vapor de gua Va = 1309,97
Vazo da corrente Vn+1 = 1184,7 kg/h
W1 = -nRT1ln(P1/P2); Q1 =
W2 = -nR(T2-T1); Q2 = Cpn(T2-T1)
T2 = 580K
P2 =7,06 bar
Somatrio= 61649,16
P = 0,9729 m

Sim, pois mpy = 0,0222 pol/ano

Anidrido actico
2 CH3COOH > CH3COOCOCH3 +
Quantidade de cido necessria =
YAn+1 = 0,0526; YAa=0,0473
XAa=0; m=1,9; A=0,277
W=825m^2/s^2
W=850m^2/s^2

2007
QUESTO ITEM
1a
b

DENIS

Nathlia Martins

No.
m(mx) = 0,2 kg

No
0,2

R = 2,05 K/W

V2 = 102 kg

101,8 kg

4a
b

k = 0,6 (mg/L.min)
Vm = 75 x 10^3 L

idem
idem

p(B) = 36102,5 kgf/m^2 ; h = 1,89 m


v(ST) = 8,5 m/s
h(BT) = 6,31 m

p(B) = 25.770,69 kgf/m^2; h=1,89m


v = 8,49 m/s
h = 6,55 m

5
6a
b
c
7a
b
8a
b

Reaes muito eficientes, alta formao

DENIS
QUESTO

ITEM
1

A = 38 ft^2

2a
b
3a
b

m = 3,853 kg
m(total) = 6715,7 g

4a
b
5
6a
b

H1 = 0,0114 kg H2O/kg ar seco ; RH6 = 0,43

7a
b

Conc. = 0,184 mol/L


% Cl- = 12,25%

8a
b

2004
QUESTO ITEM
1a
b
2a
b

DENIS

t = 1320 s
Nbi = 8,64 x 10^-4 (hiptese vlida)

3a
b
4a
b

W1 = -Q1 = 33256 ln p2 ; W2 = -83,14 (T2 - 400) , Q2 = 400 (T2 - 400)


T2 = 580 K ; p2 = 7,06 bar

5
6a
b
7a
b
8a
b

v1 = 1,16 m/s ; v2 = 4,64 m/s


Q = 5,69 x 10^-2 (m^3/s)

BRUNA

Idem

W1 = -Q1 = 33256 ln p2 ; W2 = -83,14 (T2 - 400) , Q2 = 400 (T2 - 400)


T2 = 580 K ; p2 = 7,06 bar

v1 = 1,1 m/s ; v2 = 4,4 m/s


Q = 3,45 (m^3/s)